SMU-L11 | MedChemExpress (MCE)
SMU-L11 is a specific TLR7 agonist (EC50=0.024 μM), which recruits MyD88 adapter protein and activates downstream NF-κB and MAPK signaling pathways. In murine models, SMU-L11 significantly enhances immune cell activation and promotes the proliferation of CD4+ T and CD8+ T cells, thereby directly killing tumor cells and inhibiting tumor growth. SMU-L11 can be used for cancer research, and also has the potential for studying immune system diseases[1].
Trivial name | SMU-L11 |
Catalog Number | HY-157793 |
Research Area | Inflammation/Immunology; Cancer |
Purity | ≥98.0% |
SMILES | CCCCC1=NC2=C(N1CC3CCOC3)C4=CC=CC=C4N=C2N |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/smu-l11.html |