RTx-161 | MedChemExpress (MCE)
RTx-161 is an allosteric Polθ polymerase inhibitor with an IC50 value of 4.1 nM. RTx-161 selectively kills HR-deficient cancer cells and suppresses PARP inhibitor (PARPi) resistance in multiple genetic backgrounds, including HR-proficient cells. Additionally, RTx-161 can induce apoptosis[1].

Trivial name | RTx-161 |
Catalog Number | HY-161430 |
Research Area | Cancer |
Purity | ≥98.0% |
SMILES | FC(F)(F)C1=CC(N2CCN(CCO)C2=O)=C(OC(N(C3=CC=C(F)C=C3)C)=O)C(C(F)(F)F)=C1 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/rtx-161.html |