Ribavirin-15N, d2 | MedChemExpress (MCE)
Ribavirin-15N, d2 is 15N and deuterated labeled Ribavirin (HY-B0434). Ribavirin (ICN-1229) is an antiviral agent against a broad spectrum of viruses including HCV, HIVl, and RSV. Ribavirin also has anti-orthopoxvirus and anti-variola activities.
| Trivial name | Ribavirin-15N, d2 |
| Catalog Number | HY-B0434S1 |
| Alternative Name(s) | ICN-1229-15N, d2 |
| Research Area | Infection; Cancer |
| Purity | ≥98.0% |
| SMILES | O[C@H]1[C@@H](O)[C@H](N2N=C(C([15NH2])=O)N=C2)O[C@@H]1C([2H])([2H])O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ribavirin-15n-d2.html |