(R)-MPH-220 | MedChemExpress (MCE)
(R)-MPH-220 is the R isomer of MPH-220 (HY-148516). MPH-220 is a selective and orally active inhibitor of skeletal muscle myosin-2. MPH-220 enables muscle relaxation. MPH-220 is anti-spastic agent that can be used in the research of spasticity and muscle stiffness[1].
| Trivial name | (R)-MPH-220 |
| Catalog Number | HY-148516A |
| Research Area | Neurological Disease |
| Purity | 98.7% |
| SMILES | O[C@]12C(N(C3=CC=C(N4CCOCC4)C=C3)CC2)=NC5=C(C=C(S5)C)C1=O |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/r-mph-220.html |