PSI-6206-d1,13C,15N2 | MedChemExpress (MCE)
PSI-6206-d1,13C,15N2 is 15N and 13C labeled PSI-6206 (HY-15236). PSI-6206 (RO 2433) is the deaminated derivative of PSI-6130, which is a potent and selective inhibitor of HCV NS5B polymerase. PSI-6206 low potently inhibits HCV replicon with EC90 of >100 μM.
| Trivial name | PSI-6206-d1,13C,15N2 |
| Catalog Number | HY-15236S1 |
| Alternative Name(s) | RO 2433--d1,13C,15N2; GS-331007--d1,13C,15N2 |
| Research Area | Infection |
| Purity | ≥98.0% |
| SMILES | OC[C@@H]1[C@@H](O)[C@](F)(C)[C@@]([15N]2[13C]([15NH]C(C=C2)=O)=O)([2H])O1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/psi-6206-d1-13c-15n2.html |