PROTAC PARP1 degrader-1 | MedChemExpress (MCE)
PROTAC PARP1 degrader-1 (Compound CN0) is a PROTAC degrader of PARP1. PROTAC PARP1 degrader-1 activates the cGAS/STING immunity pathway and eventually enhances T cell killing of tumor cells. PROTAC PARP1 degrader-1 inhibits DNA damage repair, resulting in highly efficient accumulation of cytosolic DNA fragments (Blue: CRBN ligand, Black: linker; Pink: PARP1 inhibitor)[1].
| Trivial name | PROTAC PARP1 degrader-1 |
| Catalog Number | HY-158045 |
| Research Area | Inflammation/Immunology; Cancer |
| Purity | ≥98.0% |
| SMILES | NC(C1=CC=CC2=CN(N=C21)C3=CC=C(C=C3)C4CN(CCC4)C5=C(C6=CC=C5)C(N(C6=O)C7CCC(NC7=O)=O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/protac-parp1-degrader-1.html |
