PBX-7011 TFA | MedChemExpress (MCE)
PBX-7011 TFA is a derivative of camptothecin (HY-16560), which inhibits expressions of the cancer related survival genes DDX5, Survivin, Mcl-1 and XIAP in cells FaDu, degrades DDX5 proteins and exhibits anticancer activity[1].
Trivial name | PBX-7011 TFA |
Catalog Number | HY-160438B |
Research Area | Cancer |
Purity | ≥98.0% |
SMILES | O=C(O)C(F)(F)F.N[C@@H]1C2=C3C(C=C4C(OCO4)=C3CC1)=NC5=C2CN6C5=CC7=C(COC([C@]7(O)CC)=O)C6=O |
Size | 25 mg |
Supplier Page | https://www.medchemexpress.com/pbx-7011-tfa.html |