Oseltamivir acid-13C,d3 | MedChemExpress (MCE)
Oseltamivir acid-13C,d3 (GS 4071-13C,d3; Ro 64-0802-13C,d3) is a 13C- and deuterium-labeled Oseltamivir acid (HY-13318). Oseltamivir acid is the active metabolite of Oseltamivir phosphate and inhibits influenza virus neuraminidase (IC50=2 nM). Oseltamivir acid is orally active and can be used to study influenza A/B infections[1][2][3][4][5].
| Trivial name | Oseltamivir acid-13C,d3 |
| Catalog Number | HY-13318S1 |
| Alternative Name(s) | GS 4071-13C,d3; Ro 64-0802-13C,d3; Oseltamivir carboxylate-13C,d3 |
| Research Area | Infection |
| Purity | ≥98.0% |
| SMILES | O=C(O)C1=C[C@@H](OC(CC)CC)[C@H](NC([13C]([2H])([2H])[2H])=O)[C@@H](N)C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/oseltamivir-acid-13c-d3.html |