NLRP3-IN-32 | MedChemExpress (MCE)
NLRP3-IN-32 (compound 7a), a 3, 4-dihydronaphthalene-1(2H)-one derivative, is a potential NLRP3 inflammatory vesicles inhibitor. NLRP3-IN-32 can block the assembly and activation of NLRP3 inflammasome by down-regulating the expression of NLPR3 and apoptosis-associated speck-like protein containing a CARD (ASC), and inhibiting the production of reactive oxygen species (ROS) and other inflammatory mediators. NLRP3-IN-32 inhibits the phosphorylation of IκBα and NF-κB/p65 and the nuclear translocation of p65, thereby inhibiting NF-κB signaling[1].
Trivial name | NLRP3-IN-32 |
Catalog Number | HY-161329 |
Research Area | Inflammation/Immunology |
Purity | ≥98.0% |
SMILES | O=C(C1=C(CC/2)C=CC(Br)=C1)C2=C\C3=NC=C(N4CCN(C)CC4)C=C3 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/nlrp3-in-32.html |