Nampt activator-5 | MedChemExpress (MCE)
Nampt activator-5 (compound C8) is a potent nicotinamide phosphoribosyltransferase (NAMPT) activator with a KD value of 6.19 µM. Nampt activator-5 shows a cellular antisenescence effect. Nampt activator-5 promotes the production of NAD+ in the brain and reduces the expression of age-related markers and secretory phenotypes. Nampt activator-5 has the potential for the research of age-related diseases[1].
| Trivial name | Nampt activator-5 |
| Catalog Number | HY-162269 |
| Research Area | Neurological Disease |
| Purity | ≥98.0% |
| SMILES | O=C(NCC1=CC=NC=C1)NC2=CC=C(S(NCC3=C(C=CC(F)=C3)F)(=O)=O)C=C2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/nampt-activator-5.html |