N6-Methyladenosine-13C3 | MedChemExpress (MCE)
N6-Methyladenosine-13C3 (6-Methyladenosine-13C3) is 13C-labeled N6-Methyladenosine (HY-N0086). N6-Methyladenosine is the most prevalent internal (non-cap) modification present in the messenger RNA (mRNA) of all higher eukaryotes. N6-Methyladenosine can modifies viral RNAs and has antiviral activities[1][2][3].
| Trivial name | N6-Methyladenosine-13C3 |
| Catalog Number | HY-N0086S3 |
| Alternative Name(s) | 6-Methyladenosine-13C3; N-Methyladenosine-13C3 |
| Research Area | Infection |
| Purity | ≥98.0% |
| SMILES | O[C@H]1[C@@H](O)[C@H](N2[13CH]=NC3=C2N=[13CH]N=C3N[13CH3])O[C@@H]1CO |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/n6-methyladenosine-13c3.html |