MenA-IN-1 | MedChemExpress (MCE)
MenA IN-1 is an effective inhibitor of 1,4-dihydroxy-2-naphthoate isoprenyltransferase (MenA) from Mycobacterium tuberculosis (MTB) with an IC50 value of 13 µM and an GIC50 value of 8 µM. MenA IN-1 can be used to curb the continuous spread of tuberculosis[1].
| Trivial name | MenA-IN-1 |
| Catalog Number | HY-152495 |
| Research Area | Infection |
| Purity | ≥98.00% |
| SMILES | CCCN(C1=CC=C(C=C1)CN2CCC(CC2)COC3=CC(OC4=CC=CC=C4)=CC=C3)C |
| PubChem Chemical Structure ID | 166642583 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mena-in-1.html |