Meliadubin B | MedChemExpress (MCE)
Meliadubin B is a natural triterpenoid with significant inflammatory inhibition effect toward superoxide anion generation in human neutrophils (EC50 of 5.54 μM). Meliadubin B inhibits inducible nitric oxide synthase. Meliadubin B shows remarkable inhibition against the rice pathogenic fungus Magnaporthe oryzae with IC50 of 182.50 μM.
| Trivial name | Meliadubin B |
| Catalog Number | HY-156241 |
| Research Area | Inflammation/Immunology; Infection |
| Purity | ≥98.00% |
| SMILES | O[C@@H]1C[C@@]2(C)[C@]([C@](CO1)(C)C(O)=O)(CC=C3[C@]2([H])CC[C@]4(C)[C@]3(C)CC[C@H]4[C@@H](C)CC/C=C(C)\C)[H] |
| PubChem Chemical Structure ID | 168679758 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/meliadubin-b.html |