MDEG-541 | MedChemExpress (MCE)
MDEG-541 is a potent MYC-MAX degrader. MDEG-541 is a PROTAC that based on the MYC-MAX dimerization inhibitor 10058-F4 derivative 28RH and Thalidomide (HY-14658). MDEG-541 shows antiproliferative activity. MDEG-541 decreases the expression of GSPT1, MYC, GSPT2, PLK1 protein[1].
| Trivial name | MDEG-541 |
| Catalog Number | HY-150259 |
| Research Area | Cancer |
| Purity | ≥98.00% |
| SMILES | O=C(C1=CC2=C(C(N(C(CC3)C(NC3=O)=O)C2=O)=O)C=C1)NCCCCCCCCN(C/4=O)C(SC4=C/C5=CC=C(C(C)C)C=C5)=S |
| PubChem Chemical Structure ID | 164946931 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mdeg-541.html |