MC4171 | MedChemExpress (MCE)
MC4171 (compound 34) is a selective KAT8 inhibitor (IC50=8.1 µM). MC4171 has been shown to exhibit moderate micromolar antiproliferative activity in different cancer cell lines, including NSCLC and AML, with potential for studying cancer[1].
| Trivial name | MC4171 |
| Catalog Number | HY-153604 |
| Research Area | Cancer |
| Purity | ≥98.00% |
| SMILES | O=C(O)C1=CC=C(N2N=C(C3=CC=CC=C3)/C(C2=O)=C/C4=CC=CN4)C=C1 |
| PubChem Chemical Structure ID | 168475934 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mc4171.html |