MARK4 inhibitor 3 | MedChemExpress (MCE)
MAPK4 inhibitor 3 (compound 23b) is an inhibitor of MAPK4 with an IC50 value of 1.01 μM. MAPK4 inhibitor 3 inhibits cancer cells growth. MAPK4 inhibitor 3 can be used for research on cancer and tauopathies[1].
| Trivial name | MARK4 inhibitor 3 |
| Catalog Number | HY-154987 |
| Research Area | Cancer |
| Purity | ≥98.00% |
| SMILES | O=C(NC1=CC=C(F)C=C1)[C@@H](NC(CN(C2=C3C=CC=C2)C4=CC=C(C)C=C4C3=O)=O)CC5=CNC6=C5C=CC=C6 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mark4-inhibitor-3.html |