MAO-B-IN-18 | MedChemExpress (MCE)
MAO-B-IN-18 is a potent and selective MAO B inhibitor with IC50s of 52 nM and 14 μM for hMAO B and hMAO A, respectively. MAO-B-IN-18 enables promising cytoprotective effects against hydrogen peroxide insults in neuroblastoma and astrocytes cultures[1].
| Trivial name | MAO-B-IN-18 |
| Catalog Number | HY-149234 |
| Research Area | Neurological Disease |
| Purity | 99.84% |
| SMILES | COC1=CC(COC2=CC=C(C=C2)C3=NOC(C4=CC=C5NN=CC5=C4)=N3)=CC(OC)=C1OC |
| PubChem Chemical Structure ID | 168355506 |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/mao-b-in-18.html |