M4K2281 | MedChemExpress (MCE)
M4K2281 is a selecitve inhibitor for activin receptor-like kinase-2 (ALK2) with an IC50 of 2 nM. M4K2281 exhibits a moderate blood brain permeability with a brain to plasma ratio of 3.7 at 4h[1].
| Trivial name | M4K2281 |
| Catalog Number | HY-161376 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | CN1CCN(CC1)C2=CC=C3C(OCCC4=C3C=NC=C4C5=CC(OC)=C(C(OC)=C5)OC)=C2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/m4k2281.html |