Lysyl hydroxylase 2-IN-2 | MedChemExpress (MCE)
Lysyl hydroxylase 2-IN-2 (compound 13) is a potent Lysyl hydroxylase 2 (LH2) inhibitor, with the IC50 of approximately 500 nM. Lysyl hydroxylase 2-IN-2 inhibits the migration in 344SQ WT cells, but not impedes the migration of the same cell line with an LH2 knockout cells[1].
| Trivial name | Lysyl hydroxylase 2-IN-2 |
| Catalog Number | HY-149611 |
| Research Area | Cancer |
| Purity | ≥98.00% |
| SMILES | O=C(C1=CC=CC(N2CCN(C)CC2)=C1)CC(C3=CC=NC=C3)=O |
| PubChem Chemical Structure ID | 169450101 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lysyl-hydroxylase-2-in-2.html |