LWY713 | MedChemExpress (MCE)
LWY713 is a FLT3 degrader (DC50=0.64 nM) that selectively induces FLT3 degradation in a cereblon- and proteasome-dependent manner. LWY713 inhibits cell proliferation and induces G0/G1 arrest and apoptosis in MV4-11 cells. LWY713 exhibits potent in vivo antitumor activity in an MV4-11 xenograft model[1].
| Trivial name | LWY713 |
| Catalog Number | HY-157213 |
| Research Area | Cancer |
| Purity | ≥98.00% |
| SMILES | O=C1C2=CC=CC(OCC(N3CCN(C4CCN(C5=CC=C(C=C5OC)NC6=C(C(N)=O)N=C(CC)C(NC7CCOCC7)=N6)CC4)CC3)=O)=C2CN1C8C(NC(CC8)=O)=O |
| PubChem Chemical Structure ID | 169450509 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lwy713.html |