LSD1-IN-26 | MedChemExpress (MCE)
LSD1-IN-26 (compound 12u) is a potent LSD1 inhibitor, with an IC50 of 25.3 nM. LSD1-IN-26 also inhibits MAO-A (IC50=1234.57 nM) and MAO-B (IC50=3819.27 nM). LSD1-IN-26 significantly induces apoptosis in MGC-803 cells. LSD1-IN-26 can be used for gastric cancer research[1].
| Trivial name | LSD1-IN-26 |
| Catalog Number | HY-149978 |
| Research Area | Cancer |
| Purity | ≥98.00% |
| SMILES | O=C(N1CCN(CC1)C2=CC(Cl)=C(C=C2)Cl)C3=CC=CC(CN[C@@H]4C[C@H]4C5=CC=C(C(F)=C5)F)=C3 |
| PubChem Chemical Structure ID | 168355547 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lsd1-in-26.html |