Lonodelestat TFA | MedChemExpress (MCE)
Lonodelestat TFA (POL6014 TFA) is a potent, orally active and selective peptide inhibitor of human neutrophil elastase (hNE). Lonodelestat TFA has the potential for the research of cystic fibrosis (CF)[1][2][3].
| Trivial name | Lonodelestat TFA |
| Catalog Number | HY-P3293A |
| Alternative Name(s) | POL6014 TFA |
| Research Area | Inflammation/Immunology |
| Purity | 99.86% |
| SMILES | O=C(O)C(F)(F)F.O=C(N(CCC1)[C@]1([H])C(N[C@H](C(N[C@H](C(N[C@@](C(N[C@H](C(N[C@H]2CO)=O)C)=O)([H])[C@H](O)C)=O)CCC(O)=O)=O)CCCCCCCC)=O)[C@](CCC3)([H])N3C([C@@H](NC([C@@H](NC([C@@H](NC([C@@](CCC4)([H])N4C([C@@](CCC5)([H])N5C([C@](NC2=O)([H])[C@@H](C)CC)=O)=O)=O)CCC(N)=O)=O)CCCCN)=O)CC(C=C6)=CC=C6O)=O |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/lonodelestat-tfa.html |