LM-41 | MedChemExpress (MCE)
LM-41 is a Flufenamic acid-derived TEAD inhibitor hat strongly reduce the expression of CTGF, Cyr61, Axl and NF2. LM-41 inhibits migration of human MDA-MB-231 breast cancer cells[1].
| Trivial name | LM-41 |
| Catalog Number | HY-155309 |
| Research Area | Cancer |
| Purity | ≥98.00% |
| SMILES | OC(C1=CC=C(F)C=C1NC2=CC(C3=CC=CC=C3)=CC=C2)=O |
| PubChem Chemical Structure ID | 169410436 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lm-41.html |