LM-021 | MedChemExpress (MCE)
LM-021 is a coumarin-chalcone derivative with anti-aggregatory, antioxidant, neuroprotective and anti-inflammatory properties which suppresses nitric oxide (NO), IL-1β, IL-6, TNF-α production, CD68 antigen (CD68) and histocompatibility-2 (MHCII) expression. LM-021 also attenuates the increase of caspase 1 activity, lactate dehydrogenase release and ROS level. LM-021 can be used for neurological research[1].
| Trivial name | LM-021 |
| Catalog Number | HY-157992 |
| Research Area | Neurological Disease; Inflammation/Immunology |
| Purity | ≥98.0% |
| SMILES | CN(C1=CC=C(C=C1)/C=C/C(C2=C(C3=CC=CC=C3OC2=O)O)=O)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lm-021.html |