LasB-IN-1 | MedChemExpress (MCE)
LasB-IN-1 (compound 5f) is a potent and orally active inhibitor of LasB (IC50 = 8.7 μM). LasB-IN-1 effectively attenuates elastase production and biofilm formation by P. aeruginosa while alleviating the inflammatory response through downregulating MAPK and NF-κB pathways. LasB-IN-1 is potential to be a novel anti-infective candidate against drug-resistant infections[1].
| Trivial name | LasB-IN-1 |
| Catalog Number | HY-163030 |
| Research Area | Inflammation/Immunology; Infection |
| Purity | ≥98.00% |
| SMILES | O=C1N(CC2=CC=C(C(F)(F)F)C=C2)C(O)(CCCC)C3=C1C=CCC3 |
| PubChem Chemical Structure ID | 168875457 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lasb-in-1.html |