Laccase-IN-1 | MedChemExpress (MCE)
Laccase-IN-1 (compound 4b) is an orally active inhibitor of laccase, with the IC50 of 11.3 μM. Laccase-IN-1displays protective and curative effects on apple fruits infected by B. dothidea. Laccase-IN-1 enhances the cell membrane permeability, destroys the mycelial surface morphology and the cell ultrastructure, and reduces the ergosterol and exopolysaccharide contents of B. dothidea[1].
| Trivial name | Laccase-IN-1 |
| Catalog Number | HY-149614 |
| Research Area | Infection |
| Purity | ≥98.00% |
| SMILES | FC(C=C1)=CC=C1NNC([C@@]2(CC[C@@]3(C2(C)C)C)OC3=O)=O |
| PubChem Chemical Structure ID | 169450106 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/laccase-in-1.html |