KSDSC TFA | MedChemExpress (MCE)
KSDSC TFA is a penta-peptide, correlated positively with hairpin DNA with tetramer loops. Therefore, KSDSC TFA joins hands with hairpin DNA (hpDNA) with improved selectivity as sensing materials in the detection system, used for surface plasmon resonance imaging (SPRi)[1].
| Trivial name | KSDSC TFA |
| Catalog Number | HY-P5228A |
| Research Area | Others |
| Purity | ≥98.00% |
| SMILES | OC([C@H](CS)NC([C@H](CO)NC([C@H](CC(O)=O)NC([C@H](CO)NC([C@@H](N)CCCCN)=O)=O)=O)=O)=O.OC(C(F)(F)F)=O |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/ksdsc-tfa.html |