KRAS G12C inhibitor 60 | MedChemExpress (MCE)
KRAS G12C inhibitor 60 (compound 23) is a Kras-G12C inhibitor. KRAS G12C inhibitor 60 can be used for the research of lung cancer, colorectal cancer, pancreatic cancer[1].
| Trivial name | KRAS G12C inhibitor 60 |
| Catalog Number | HY-153944 |
| Research Area | Cancer |
| Purity | ≥98.00% |
| SMILES | FC1=CC2=C(N=C1C3=C(F)C=CC=C3N)N(C4=C([C@@H](C(F)(F)F)C)N=CC=C4C)C(N=C2N5C[C@@H](C)N(C(C=C)=O)C[C@@H]5C)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kras-g12c-inhibitor-60.html |