KN-17 | MedChemExpress (MCE)
KN-17 is a modified based on the structure of cecropin B (HY-P0092), can effectively interfere with bacterial growth and induce the migration of human bone marrow stromal cells (hBMSCs). KN-17 can significantly stimulate angiogenesis in vitro and in vivo[1].

Trivial name | KN-17 |
Catalog Number | HY-162346 |
Research Area | Infection |
Purity | ≥98.0% |
SMILES | CC(C(N[C@@H](CC1=CC=CC=C1)C(N[C@@H](CC2=CC=CC=C2)C(N[C@@H](CCC(O)=O)C(N[C@@H](CC3=CC=C(O)C=C3)C(O)=O)=O)=O)=O)=O)C4=CC=C5C(C=CC(OC)=C5)=C4 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/kn-17.html |