Kagimminol B | MedChemExpress (MCE)
Kagimminol B, a cembrene-type diterpenoid, can be isolated from an Okeania sp. marine cyanobacterium. Kagimminol B shows selective growth-inhibitory activity against the causative agent of human African trypanosomiasis[1].

Trivial name | Kagimminol B |
Catalog Number | HY-N12637 |
Research Area | Infection |
Purity | ≥98.0% |
SMILES | C/C1=C\C=C(C(C)C)/[C@@H](OC(C)=O)C[C@](C(/C=C([C@@](O)(C)CCC1)\O)=O)(C)O |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/kagimminol-b.html |