Julichrome Q3.5 | MedChemExpress (MCE)
Julichrome Q3.5 (Compound 4) is a bioherbicide that completely inhibits the growth of cabbage. Julichrome Q3.5 can be isolated from the supernatant extract of strain Streptomyces sp. NEAU-HV44[1].
| Trivial name | Julichrome Q3.5 |
| Catalog Number | HY-157017 |
| Research Area | Others |
| Purity | ≥98.00% |
| SMILES | O=C1C2=CC=C(C3=CC=C(C([C@@]4([C@]([C@H](OC(C)=O)C)([H])[C@@](C)(O)CC5=O)[C@]5(O4)[C@H]6O)=O)C6=C3O)C(O)=C2C(C7=C(O)C=C(C)C(C(C)=O)=C71)=O |
| PubChem Chemical Structure ID | 169450372 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/julichrome-q3-5.html |