JT001 sodium | MedChemExpress (MCE)
JT001 (NLRP3-IN-19) sodium is a potent, specific and orally active inhibitor of NLRP3. JT001 sodium can inhibit NLRP3 inflammasome assembly, resulting in the inhibition of cytokine release and the prevention of pyroptosis. JT001 sodium can be used for the research of nonalcoholic steatohepatitis and liver fibrosis[1].
| Trivial name | JT001 sodium |
| Catalog Number | HY-156034A |
| Alternative Name(s) | NLRP3-IN-19 sodium |
| Research Area | Inflammation/Immunology |
| Purity | ≥98.00% |
| SMILES | O=C(NS(=O)(C1=C2OCCCN2N=C1)=O)NC3=C4CCCC4=CC5=C3CCC5.[Na] |
| PubChem Chemical Structure ID | 168510474 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/nlrp3-in-19-sodium.html |