α-Glucosidase-IN-57 | MedChemExpress (MCE)
α-Glucosidase-IN-57 (Compound 10c) is a competitive and orally active α-glucosidase inhibitor with an IC50 value of 0.180 μM and a Ki of 0.15 μM. α-Glucosidase-IN-57 can reduce fasting and overall blood glucose levels in mice, and can be used for anti-diabetes research[1].
| Trivial name | α-Glucosidase-IN-57 |
| Catalog Number | HY-163433 |
| Research Area | Metabolic Disease |
| Purity | ≥98.0% |
| SMILES | O=C(CSC1=NC2=CC=CC=C2C=C1C3=NC(C4=CC=CC=C4)=C(N3)C5=CC=CC=C5)NC6=CC=C(F)C=C6 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-glucosidase-in-57.html |