α-Glucosidase-IN-44 | MedChemExpress (MCE)
α-Glucosidase-IN-44 (compound IT4) is an inhibitor of α-glucosidase with IC50 value of 2.35 μM. α-Glucosidase-IN-44 has an oral activity. α-Glucosidase-IN-44 suppresses fasting blood glucose levels in diabetic mice[1].
| Trivial name | α-Glucosidase-IN-44 |
| Catalog Number | HY-163066 |
| Research Area | Metabolic Disease |
| Purity | ≥98.00% |
| SMILES | O=C(NCCC1=CNC2=C1C=CC=C2)CN3C(S/C(C3=O)=C\C4=CC=C(C)C=C4)=O |
| PubChem Chemical Structure ID | 169494209 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-glucosidase-in-44.html |