α-Glucosidase-IN-41 | MedChemExpress (MCE)
α-Glucosidase-IN-41 (compound 5o) is a potent α-glucosidase inhibitor. α-Glucosidase-IN-41 can arise the changed secondary structure of α-Glu to hinder enzyme catalytic activity. α-Glucosidase-IN-41 can be used for diabetes mellitus research[1].
| Trivial name | α-Glucosidase-IN-41 |
| Catalog Number | HY-149668 |
| Research Area | Metabolic Disease |
| Purity | ≥98.00% |
| SMILES | COC1=CC(/C=N/NC2=NN=C(SC3)N2N=C3C4=CC=CC=C4)=CC(OC)=C1O |
| PubChem Chemical Structure ID | 169450348 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-glucosidase-in-41.html |