α-Glucosidase-IN-32 | MedChemExpress (MCE)
α-Glucosidase-IN-32 (compound f26) is a reversible, noncompetitive and orally active α-glucosidase inhibitor with an IC50 value of 3.07 μM. α-Glucosidase-IN-32 complex with α-glucosidase through hydrogen bonds and hydrophobic interactions, led to changes in the conformation and secondary strictures of α-glucosidase and further the inhibition of the enzymatic activity. α-Glucosidase-IN-32 can be used for diabetic disease research[1].
| Trivial name | α-Glucosidase-IN-32 |
| Catalog Number | HY-156078 |
| Research Area | Metabolic Disease |
| Purity | ≥98.00% |
| SMILES | C1(C2=NC(C3=NN=C(SCC4=CC=CC=C4C5=CC=CC=C5)O3)=CC6=C2NC7=CC=CC=C67)=CC=CC=C1 |
| PubChem Chemical Structure ID | 168510476 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-glucosidase-in-32.html |