FITC-Lithocholic acid 3-sulfate | MedChemExpress (MCE)
FITC-Lithocholic acid 3-sulfate (FITC-Sulfolithocholic acid) is a FITC-labeled Lithocholic acid 3-sulfate, which is a sulfated biliary metabolite. Lithocholic acid 3-sulfate selectively inhibits Th17 cell differentiation by targeting RORγt. Lithocholic acid 3-sulfate can be used for the research of pathogenesis of cholestatic liver diseases[1].
| Trivial name | FITC-Lithocholic acid 3-sulfate |
| Catalog Number | HY-113238F |
| Alternative Name(s) | FITC-Sulfolithocholic acid |
| Research Area | Others |
| Purity | ≥98.0% |
| SMILES | C[C@H](CCC(NCCNC(NC1=CC=C(C2=C(C=C3)C(OC4=C2C=CC(O)=C4)=CC3=O)C(C(O)=O)=C1)=S)=O)[C@H]5CC[C@@]6([H])[C@]7([H])CC[C@]8([H])C[C@H](OS(=O)(O)=O)CC[C@]8(C)[C@@]7([H])CC[C@]56C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/fitc-lithocholic-acid-3-sulfate.html |