Esomeprazole-d3 potassium | MedChemExpress (MCE)
Esomeprazole-d3 potassium is deuterated labeled Esomeprazole (HY-17021). Esomeprazole ((S)-Omeprazole) is a potent and orally active proton pump inhibitor and reduces acid secretion through inhibition of the H+, K+-ATPase in gastric parietal cells. Esomeprazole has the potential for symptomatic gastroesophageal reflux disease research[1][2][3].
| Trivial name | Esomeprazole-d3 potassium |
| Catalog Number | HY-17021S2 |
| Alternative Name(s) | (S)-Omeprazole-d3 potassium; (-)-Omeprazole-d3 potassium |
| Research Area | Inflammation/Immunology; Endocrinology; Cancer |
| Purity | ≥98.0% |
| SMILES | O=[S@@](CC1=NC=C(C(OC)=C1C)C)C2=NC3=CC(OC([2H])([2H])[2H])=CC=C3N2[K] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/esomeprazole-d3-potassium.html |