EGFR WT/T790M-IN-1 | MedChemExpress (MCE)
EGFR WT/T790M-IN-1 (Compound 16h) is a dual EGFR WT and EGFR T790 inhibitor. EGFR WT/T790M-IN-1 can arrest the cell cycle in G2/M phase and induce apoptosis. EGFR WT/T790M-IN-1 has anti-cancer activity[1].
| Trivial name | EGFR WT/T790M-IN-1 |
| Catalog Number | HY-163371 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | O=C(C1=COC(C2=NC(C3=CC(OC)=C(OC)C(OC)=C3)=NC=C2)=N1)NC4=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C4 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/egfr-wt-t790m-in-1.html |