EGFR-IN-108 chloride | MedChemExpress (MCE)
EGFR-IN-108 chloride (Compound Ru3S) is an EGFR inhibitor with an IC50 value of 5.8 nM for hEGFR. EGFR-IN-108 chloride induces apoptosis and has anti-proliferative activity against cancer cells. EGFR-IN-108 chloride also has anti-angiogenic effects[1].
| Trivial name | EGFR-IN-108 chloride |
| Catalog Number | HY-163402 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | CC1=[N]2[Ru+2]3([N]4=C(C)C=CC=C4C5=CC=CC(C)=[N]35)([N]6=CC=C(OC7=CC=C(NC(NC8=CC=C(Cl)C(C(F)(F)F)=C8)=O)C=C7)C=C6C9=O)([NH]9C)[N]%10=C(C)C=CC=C%10C2=CC=C1.[Cl-].[Cl-] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/egfr-in-108-chloride.html |