Dutasteride-13C,15N,d | MedChemExpress (MCE)
Dutasteride-13C,15N,d is 15N and deuterated labeled Dutasteride (HY-13613). Dutasteride (GG745) is a potent inhibitor of both 5α-reductase isozymes. Dutasteride may possess off-target effects on the androgen receptor (AR) due to its structural similarity to DHT[1].
| Trivial name | Dutasteride-13C,15N,d |
| Catalog Number | HY-13613S2 |
| Alternative Name(s) | GG 745-13C,15N,d; GI 198745-13C,15N,d |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | O=[13C]([C@H]1C([2H])C[C@]2([H])[C@]1(C)CC[C@]3([H])[C@@]4(C)C=CC([15NH][C@]4([H])CC[C@]32[H])=O)NC5=CC(C(F)(F)F)=CC=C5C(F)(F)F |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/dutasteride-13c-15n-d.html |