Dinoprost-13C5 | MedChemExpress (MCE)
Dinoprost-13C5 is 13C labeled Dinoprost (HY-12956). Dinoprost (Prostaglandin F2α) is an orally active, potent prostaglandin F (PGF) receptor (FP receptor) agonist. Dinoprost is a luteolytic hormone produced locally in the endometrial luminal epithelium and corpus luteum (CL). Dinoprost plays a key role in the onset and progression of labour[1][2].
| Trivial name | Dinoprost-13C5 |
| Catalog Number | HY-12956S2 |
| Alternative Name(s) | Prostaglandin F2α-13C5; PGF2α-13C5 |
| Research Area | Endocrinology |
| Purity | ≥98.0% |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=[13C]\[13C][13C][13C][13C](O)=O)[C@@H](O)C[C@H]1O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/dinoprost-13c5.html |