DBCO-PEG6-NHS ester | MedChemExpress (MCE)

DBCO-PEG6-NHS ester is a click chemistry PEG reagent containing an NHS ester that reacts specifically with primary amines, such as side chains of lysine residues or aminosilane-coated surfaces, under neutral or slightly alkaline conditions. , efficient reaction to form covalent bonds. DBCO-PEG6-NHS ester also contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups[1].

Trivial name DBCO-PEG6-NHS ester
Catalog Number HY-160773
Research Area Others
Purity ≥98.0%
SMILES O=C(N1C2=CC=CC=C2C#CC3=CC=CC=C3C1)CCC(NCCOCCOCCOCCOCCOCCOCCC(ON4C(CCC4=O)=O)=O)=O
Size 5 mg
Supplier Page https://www.medchemexpress.com/dbco-peg6-nhs-ester.html