DBCO-PEG6-NHS ester | MedChemExpress (MCE)
DBCO-PEG6-NHS ester is a click chemistry PEG reagent containing an NHS ester that reacts specifically with primary amines, such as side chains of lysine residues or aminosilane-coated surfaces, under neutral or slightly alkaline conditions. , efficient reaction to form covalent bonds. DBCO-PEG6-NHS ester also contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups[1].
Trivial name | DBCO-PEG6-NHS ester |
Catalog Number | HY-160773 |
Research Area | Others |
Purity | ≥98.0% |
SMILES | O=C(N1C2=CC=CC=C2C#CC3=CC=CC=C3C1)CCC(NCCOCCOCCOCCOCCOCCOCCC(ON4C(CCC4=O)=O)=O)=O |
Size | 10 mg |
Supplier Page | https://www.medchemexpress.com/dbco-peg6-nhs-ester.html |