Cyanine 5 Bisfunctional MTSEA Dye potassium | MedChemExpress (MCE)
Cyanine 5 Bisfunctional MTSEA Dye potassium belongs to the cyanine dye series and is a common fluorescent marker for biomolecules that can interact with biomolecules. Cyanine dyes may also bind to double-helical DNA through intercalation and exhibit enhanced fluorescence upon binding.
| Trivial name | Cyanine 5 Bisfunctional MTSEA Dye potassium |
| Catalog Number | HY-D1415 |
| Purity | ≥98.0% |
| SMILES | CC1(C(/C=C/C=C/C=C2N(C3=CC=C(C=C3C/2(C)C)S(=O)(O[K])=O)CCCCCC(NCCSS(=O)(C)=O)=O)=[N+](C4=C1C=C(C=C4)S([O-])(=O)=O)CCCCCC(NCCSS(=O)(C)=O)=O)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cyanine-5-bisfunctional-mtsea-dye-potassium.html |