μ-Conotoxin SxIIIC | MedChemExpress (MCE)
μ-Conotoxin SxIIIC is an irreversible NaV channel inhibitor that can be obtained from the Conus striolatus. μ-Conotoxin SxIIIC can be used in the study of neurological diseases such as chronic pain[1].
| Trivial name | μ-Conotoxin SxIIIC |
| Catalog Number | HY-P5855 |
| Research Area | Neurological Disease |
| Purity | ≥98.00% |
| SMILES | O=C([C@@H](N)CCCNC(N)=N)NCC(N[C@H](C(N[C@H](C(N[C@H](C(NCC(N[C@H](C(NCC(NCC(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H]1CC2=CNC3=CC=CC=C23)=O)CCCNC(N)=N)=O)CO)=O)CO)=O)CSSC[C@H](NC4=O)C(N)=O)=O)=O)=O)CCCNC(N)=N)=O)=O)CC(N)=O)=O)CSSC[C@@H]4NC5=O)=O)CSSC[C@H](NC1=O)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H]5CCCNC(N)=N)=O)C)=O)CC6=CNC=N6)=O)CC(O)=O)=O)CCCNC(N)=N)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/μ-conotoxin-sxiiic.html |