α-Conotoxin EIIB | MedChemExpress (MCE)
α-Conotoxin EIIB (Alpha-conotoxin EIIB) is a toxin peptide that can be obtained from Conus ermineus. α-Conotoxin EIIB binds to nAChR (Ki=2.2 nM). α-Conotoxin EIIB can be used in the study of neurological diseases such as schizophrenia, drug addiction, Alzheimer’s disease, and Parkinson’s disease[1].
| Trivial name | α-Conotoxin EIIB |
| Catalog Number | HY-P5852 |
| Alternative Name(s) | Alpha-conotoxin EIIB |
| Research Area | Neurological Disease |
| Purity | ≥98.00% |
| SMILES | O=C(C(N1)CCC1=O)N[C@H](C(N2[C@H](C(NCC(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N3[C@H](C(N[C@H]4C)=O)CCC3)=O)CC5=CNC=N5)=O)CC6=CNC7=CC=CC=C67)=O)CSSC[C@H](NC8=O)C(N)=O)=O)CSSC[C@H](NC4=O)C(NCC(N[C@H](C(N[C@H](C(N[C@H]8CCCNC(N)=N)=O)CC(N)=O)=O)CCCCN)=O)=O)=O)=O)CC(O)C2)=O)[C@@H](C)O |
| PubChem Chemical Structure ID | 168679732 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-conotoxin-eiib.html |