Cinnamyl Alcohol-d9 | MedChemExpress (MCE)
Cinnamyl Alcohol-d9 is deuterated labeled 3-Methoxyphenol (HY-Y1840). 3-Methoxyphenol is a phenolic compound that is biologically toxic. 3-Methoxyphenol is systemically absorbed, disrupts the function of the liver, kidneys, central nervous system, and redox processes, and increases levels of Hb, red blood cells, and white blood cells in the body.
| Trivial name | Cinnamyl Alcohol-d9 |
| Catalog Number | HY-Y0078S1 |
| Purity | ≥98.0% |
| SMILES | OC([2H])([2H])/C([2H])=C([2H])/C1=C([2H])C([2H])=C([2H])C([2H])=C1[2H] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cinnamyl-alcohol-d9.html |