Chitinase-IN-6 | MedChemExpress (MCE)
Chitinase-IN-6 (Compound 4h) is a potent dual-Chitinase inhibitor, with Ki values of 1.82 and 2.00 μM against OfChtI and OfChi-h, respectively. Chitinase-IN-6 exhibits certain growth inhibition effects against Ostrinia furnacalis. Chitinase-IN-6 is a potential novel insecticide candidate friendly to nontarget organisms[1].
| Trivial name | Chitinase-IN-6 |
| Catalog Number | HY-163352 |
| Research Area | Infection |
| Purity | ≥98.0% |
| SMILES | O=C1OC(C2=CC=C(C)C=C2)=C/C1=C\C3=CC=C(CC)C=C3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/chitinase-in-6.html |