BCH-HSP-C01 | MedChemExpress (MCE)
BCH-HSP-C01 is a lead compound that restores AP-4-dependent protein trafficking in neuronal models of adapter protein complex 4 (AP-4)-associated hereditary spastic paraplegia. BCH-HSP-C01 can be used for the research of autophagy-associated diseases[1].
| Trivial name | BCH-HSP-C01 |
| Catalog Number | HY-163329 |
| Research Area | Neurological Disease |
| Purity | ≥98.0% |
| SMILES | C1(SC(N2CCC(NC=N3)=C3C2)=N4)=C4C=CC=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/bch-hsp-c01.html |